C11H13NO2 — CID 102574080
ethyl (1R,2S,3R,4S)-3-cyanobicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 102574080) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is ethyl (1R,2S,3R,4S)-3-cyanobicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1R,2S,3R,4S)-3-cyanobicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 102574080 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | ethyl (1R,2S,3R,4S)-3-cyanobicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](C#N)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C11H13NO2/c1-2-14-11(13)10-8-4-3-7(5-8)9(10)6-12/h3-4,7-10H,2,5H2,1H3/t7-,8+,9-,10+/m1/s1 |
| InChIKey | YFXVWSKNKIBNPS-RGOKHQFPSA-N |
| XLogP | 1.51 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|