C18H21N3O2Si — CID 102574380
N-[(3R)-4,4-dicyano-3-[dimethyl(prop-2-enyl)silyl]butanoyl]benzamide (PubChem CID 102574380) has the molecular formula C18H21N3O2Si and a molecular weight of 339.47 g/mol. Its IUPAC name is N-[(3R)-4,4-dicyano-3-[dimethyl(prop-2-enyl)silyl]butanoyl]benzamide.
| Compound Name | N-[(3R)-4,4-dicyano-3-[dimethyl(prop-2-enyl)silyl]butanoyl]benzamide |
|---|---|
| PubChem CID | 102574380 |
| Molecular Formula | C18H21N3O2Si |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | N-[(3R)-4,4-dicyano-3-[dimethyl(prop-2-enyl)silyl]butanoyl]benzamide |
| SMILES | C=CC[Si](C)(C)[C@H](CC(=O)NC(=O)c1ccccc1)C(C#N)C#N |
| InChI | InChI=1S/C18H21N3O2Si/c1-4-10-24(2,3)16(15(12-19)13-20)11-17(22)21-18(23)14-8-6-5-7-9-14/h4-9,15-16H,1,10-11H2,2-3H3,(H,21,22,23)/t16-/m1/s1 |
| InChIKey | FFNOCPXIGNFLPL-MRXNPFEDSA-N |
| XLogP | 3.26 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|