C49H37N7O2 — CID 102574495
N,N-diphenyl-4-[3-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]butyl]imidazo[4,5-f][1,10]phenanthrolin-2-yl]aniline (PubChem CID 102574495) has the molecular formula C49H37N7O2 and a molecular weight of 755.88 g/mol. Its IUPAC name is N,N-diphenyl-4-[3-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]butyl]imidazo[4,5-f][1,10]phenanthrolin-2-yl]aniline.
| Compound Name | N,N-diphenyl-4-[3-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]butyl]imidazo[4,5-f][1,10]phenanthrolin-2-yl]aniline |
|---|---|
| PubChem CID | 102574495 |
| Molecular Formula | C49H37N7O2 |
| Molecular Weight | 755.88 g/mol |
| Exact Mass | 755.30 |
| IUPAC Name | N,N-diphenyl-4-[3-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenoxy]butyl]imidazo[4,5-f][1,10]phenanthrolin-2-yl]aniline |
| SMILES | c1ccc(-c2nnc(-c3ccc(OCCCCn4c(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)nc5c6cccnc6c6ncccc6c54)cc3)o2)cc1 |
| InChI | InChI=1S/C49H37N7O2/c1-4-14-35(15-5-1)48-53-54-49(58-48)36-24-28-40(29-25-36)57-33-11-10-32-55-46-42-21-13-31-51-44(42)43-41(20-12-30-50-43)45(46)52-47(55)34-22-26-39(27-23-34)56(37-16-6-2-7-17-37)38-18-8-3-9-19-38/h1-9,12-31H,10-11,32-33H2 |
| InChIKey | FEFQYODJCBUKJB-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 94.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.88 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|