C52H68N2O4 — CID 102574649
3,4,5,6-tetrakis(1-adamantylmethoxy)benzene-1,2-dicarbonitrile (PubChem CID 102574649) has the molecular formula C52H68N2O4 and a molecular weight of 785.13 g/mol. Its IUPAC name is 3,4,5,6-tetrakis(1-adamantylmethoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 3,4,5,6-tetrakis(1-adamantylmethoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 102574649 |
| Molecular Formula | C52H68N2O4 |
| Molecular Weight | 785.13 g/mol |
| Exact Mass | 784.52 |
| IUPAC Name | 3,4,5,6-tetrakis(1-adamantylmethoxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c(OCC23CC4CC(CC(C4)C2)C3)c(OCC23CC4CC(CC(C4)C2)C3)c(OCC23CC4CC(CC(C4)C2)C3)c1OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C52H68N2O4/c53-25-43-44(26-54)46(56-28-50-16-34-4-35(17-50)6-36(5-34)18-50)48(58-30-52-22-40-10-41(23-52)12-42(11-40)24-52)47(57-29-51-19-37-7-38(20-51)9-39(8-37)21-51)45(43)55-27-49-13-31-1-32(14-49)3-33(2-31)15-49/h31-42H,1-24,27-30H2 |
| InChIKey | UAZVQRWPDZNYKS-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.13 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |