C32H28N4O6 — CID 102574902
2,5,8,23,26,29-hexaoxa-14,17,35,38-tetrazaheptacyclo[28.12.0.09,22.010,15.016,21.031,36.037,42]dotetraconta-1(30),9(22),10(15),11,13,16(21),17,19,31(36),32,34,37(42),38,40-tetradecaene (PubChem CID 102574902) has the molecular formula C32H28N4O6 and a molecular weight of 564.60 g/mol. Its IUPAC name is 2,5,8,23,26,29-hexaoxa-14,17,35,38-tetrazaheptacyclo[28.12.0.09,22.010,15.016,21.031,36.037,42]dotetraconta-1(30),9(22),10(15),11,13,16(21),17,19,31(36),32,34,37(42),38,40-tetradecaene.
| Compound Name | 2,5,8,23,26,29-hexaoxa-14,17,35,38-tetrazaheptacyclo[28.12.0.09,22.010,15.016,21.031,36.037,42]dotetraconta-1(30),9(22),10(15),11,13,16(21),17,19,31(36),32,34,37(42),38,40-tetradecaene |
|---|---|
| PubChem CID | 102574902 |
| Molecular Formula | C32H28N4O6 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 2,5,8,23,26,29-hexaoxa-14,17,35,38-tetrazaheptacyclo[28.12.0.09,22.010,15.016,21.031,36.037,42]dotetraconta-1(30),9(22),10(15),11,13,16(21),17,19,31(36),32,34,37(42),38,40-tetradecaene |
| SMILES | c1cnc2c(c1)c1c(c3cccnc32)OCCOCCOc2c(c3cccnc3c3ncccc23)OCCOCCO1 |
| InChI | InChI=1S/C32H28N4O6/c1-5-21-25(33-9-1)26-22(6-2-10-34-26)30-29(21)39-17-13-37-15-19-41-31-23-7-3-11-35-27(23)28-24(8-4-12-36-28)32(31)42-20-16-38-14-18-40-30/h1-12H,13-20H2 |
| InChIKey | WGVNOEASUAPPIN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 106.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|