C29H37NO9S — CID 102575229
[(3R,5R)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 102575229) has the molecular formula C29H37NO9S and a molecular weight of 575.68 g/mol. Its IUPAC name is [(3R,5R)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3R,5R)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102575229 |
| Molecular Formula | C29H37NO9S |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | [(3R,5R)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2C[C@H]([C@H]3O[C@@H]4OC(C)(C)O[C@@H]4[C@H]4OC(C)(C)O[C@H]43)N(Cc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C29H37NO9S/c1-18-11-13-21(14-12-18)40(31,32)33-17-20-15-22(30(39-20)16-19-9-7-6-8-10-19)23-24-25(36-28(2,3)35-24)26-27(34-23)38-29(4,5)37-26/h6-14,20,22-27H,15-17H2,1-5H3/t20-,22-,23-,24+,25+,26-,27-/m1/s1 |
| InChIKey | QQRPPJHMANRCML-JDASEHJKSA-N |
| XLogP | 3.67 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|