C23H20O3 — CID 102575274
(2R,5R)-5-hydroxy-2,5-dimethylhexacyclo[9.8.1.12,6.01,3.07,20.012,17]henicosa-7,9,11(20),12,14,16-hexaene-4,21-dione (PubChem CID 102575274) has the molecular formula C23H20O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is (2R,5R)-5-hydroxy-2,5-dimethylhexacyclo[9.8.1.12,6.01,3.07,20.012,17]henicosa-7,9,11(20),12,14,16-hexaene-4,21-dione.
| Compound Name | (2R,5R)-5-hydroxy-2,5-dimethylhexacyclo[9.8.1.12,6.01,3.07,20.012,17]henicosa-7,9,11(20),12,14,16-hexaene-4,21-dione |
|---|---|
| PubChem CID | 102575274 |
| Molecular Formula | C23H20O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (2R,5R)-5-hydroxy-2,5-dimethylhexacyclo[9.8.1.12,6.01,3.07,20.012,17]henicosa-7,9,11(20),12,14,16-hexaene-4,21-dione |
| SMILES | C[C@]1(O)C(=O)C2C34CCc5ccccc5-c5cccc(c53)C1C(=O)[C@]24C |
| InChI | InChI=1S/C23H20O3/c1-21-18-20(25)22(2,26)17(19(21)24)15-9-5-8-14-13-7-4-3-6-12(13)10-11-23(18,21)16(14)15/h3-9,17-18,26H,10-11H2,1-2H3/t17?,18?,21-,22+,23?/m0/s1 |
| InChIKey | VHUVLHNZLVYYCM-UFRZXGROSA-N |
| XLogP | 3.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |