C31H31NO — CID 102576071
(4R,5R)-2-[(1S,6R)-1-methyl-4-phenyl-6-propan-2-ylcyclohexa-2,4-dien-1-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole (PubChem CID 102576071) has the molecular formula C31H31NO and a molecular weight of 433.60 g/mol. Its IUPAC name is (4R,5R)-2-[(1S,6R)-1-methyl-4-phenyl-6-propan-2-ylcyclohexa-2,4-dien-1-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R,5R)-2-[(1S,6R)-1-methyl-4-phenyl-6-propan-2-ylcyclohexa-2,4-dien-1-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 102576071 |
| Molecular Formula | C31H31NO |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (4R,5R)-2-[(1S,6R)-1-methyl-4-phenyl-6-propan-2-ylcyclohexa-2,4-dien-1-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)[C@@H]1C=C(c2ccccc2)C=C[C@]1(C)C1=N[C@H](c2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C31H31NO/c1-22(2)27-21-26(23-13-7-4-8-14-23)19-20-31(27,3)30-32-28(24-15-9-5-10-16-24)29(33-30)25-17-11-6-12-18-25/h4-22,27-29H,1-3H3/t27-,28+,29+,31-/m0/s1 |
| InChIKey | CDHRKUYLFVQDSY-MLSIGSLTSA-N |
| XLogP | 7.83 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |