About 1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone
1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone (PubChem CID 102576333) has the molecular formula C24H28O
and a molecular weight of 332.49 g/mol. Its IUPAC name is 1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone |
| PubChem CID | 102576333 |
| Molecular Formula | C24H28O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone |
| SMILES | CC1=C(Cc2ccc(C)cc2)C(CC(=O)c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C24H28O/c1-17-10-12-19(13-11-17)14-22-18(2)24(3,4)16-21(22)15-23(25)20-8-6-5-7-9-20/h5-13,21H,14-16H2,1-4H3 |
| InChIKey | JNXBJGOCKHQWCC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone?
The IUPAC name of 1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone (CID 102576333) is 1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone.
What is the SMILES notation for 1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone?
The canonical SMILES for 1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone is CC1=C(Cc2ccc(C)cc2)C(CC(=O)c2ccccc2)CC1(C)C.
What is the InChIKey of 1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone?
The InChIKey is JNXBJGOCKHQWCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O/c1-17-10-12-19(13-11-17)14-22-18(2)24(3,4)16-21(22)15-23(25)20-8-6-5-7-9-20/h5-13,21H,14-16H2,1-4H3.
What are the key properties of 1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone?
1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone has a molecular weight of 332.49 g/mol, XLogP of 6.17, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-[3,4,4-trimethyl-2-[(4-methylphenyl)methyl]cyclopent-2-en-1-yl]ethanone is sourced from PubChem (CID 102576333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).