C18H26NO3P — CID 102576513
3-[cyclohexyl(dimethoxyphosphoryl)methyl]-2-methyl-1H-indole (PubChem CID 102576513) has the molecular formula C18H26NO3P and a molecular weight of 335.38 g/mol. Its IUPAC name is 3-[cyclohexyl(dimethoxyphosphoryl)methyl]-2-methyl-1H-indole.
| Compound Name | 3-[cyclohexyl(dimethoxyphosphoryl)methyl]-2-methyl-1H-indole |
|---|---|
| PubChem CID | 102576513 |
| Molecular Formula | C18H26NO3P |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-[cyclohexyl(dimethoxyphosphoryl)methyl]-2-methyl-1H-indole |
| SMILES | COP(=O)(OC)C(c1c(C)[nH]c2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C18H26NO3P/c1-13-17(15-11-7-8-12-16(15)19-13)18(23(20,21-2)22-3)14-9-5-4-6-10-14/h7-8,11-12,14,18-19H,4-6,9-10H2,1-3H3 |
| InChIKey | IQYPGSHVDIQINW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|