C29H39N7O6 — CID 10257654
(2R)-2-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-(methylamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-(1,3-dioxobenzo[f]isoindol-2-yl)butanoic acid (PubChem CID 10257654) has the molecular formula C29H39N7O6 and a molecular weight of 581.67 g/mol. Its IUPAC name is (2R)-2-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-(methylamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-(1,3-dioxobenzo[f]isoindol-2-yl)butanoic acid.
| Compound Name | (2R)-2-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-(methylamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-(1,3-dioxobenzo[f]isoindol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 10257654 |
| Molecular Formula | C29H39N7O6 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | (2R)-2-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-(methylamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-(1,3-dioxobenzo[f]isoindol-2-yl)butanoic acid |
| SMILES | CNC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)N[C@H](CCN1C(=O)c2cc3ccccc3cc2C1=O)C(=O)O |
| InChI | InChI=1S/C29H39N7O6/c1-16(2)13-23(25(38)35-21(24(37)32-3)9-6-11-33-29(30)31)34-22(28(41)42)10-12-36-26(39)19-14-17-7-4-5-8-18(17)15-20(19)27(36)40/h4-5,7-8,14-16,21-23,34H,6,9-13H2,1-3H3,(H,32,37)(H,35,38)(H,41,42)(H4,30,31,33)/t21-,22+,23-/m0/s1 |
| InChIKey | LGAMBGLWTORDNW-ZRBLBEILSA-N |
| XLogP | 0.57 |
| TPSA | 209.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|