About (1S,5S)-7-methoxybicyclo[3.2.0]hepta-3,6-dien-2-one
(1S,5S)-7-methoxybicyclo[3.2.0]hepta-3,6-dien-2-one (PubChem CID 102577164) has the molecular formula C8H8O2
and a molecular weight of 136.15 g/mol. Its IUPAC name is (1S,5S)-7-methoxybicyclo[3.2.0]hepta-3,6-dien-2-one.
Analyze (1S,5S)-7-methoxybicyclo[3.2.0]hepta-3,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5S)-7-methoxybicyclo[3.2.0]hepta-3,6-dien-2-one?
The IUPAC name of (1S,5S)-7-methoxybicyclo[3.2.0]hepta-3,6-dien-2-one (CID 102577164) is (1S,5S)-7-methoxybicyclo[3.2.0]hepta-3,6-dien-2-one.
What is the SMILES notation for (1S,5S)-7-methoxybicyclo[3.2.0]hepta-3,6-dien-2-one?
The canonical SMILES for (1S,5S)-7-methoxybicyclo[3.2.0]hepta-3,6-dien-2-one is COC1=C[C@@H]2C=CC(=O)[C@H]12.
What is the InChIKey of (1S,5S)-7-methoxybicyclo[3.2.0]hepta-3,6-dien-2-one?
The InChIKey is GLJNSSRHASKMGI-YLWLKBPMSA-N. The full InChI is InChI=1S/C8H8O2/c1-10-7-4-5-2-3-6(9)8(5)7/h2-5,8H,1H3/t5-,8+/m0/s1.
What are the key properties of (1S,5S)-7-methoxybicyclo[3.2.0]hepta-3,6-dien-2-one?
(1S,5S)-7-methoxybicyclo[3.2.0]hepta-3,6-dien-2-one has a molecular weight of 136.15 g/mol, XLogP of 0.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5S)-7-methoxybicyclo[3.2.0]hepta-3,6-dien-2-one is sourced from PubChem (CID 102577164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).