About but-3-enyl thiophene-2-carboxylate
but-3-enyl thiophene-2-carboxylate (PubChem CID 102577380) has the molecular formula C9H10O2S
and a molecular weight of 182.24 g/mol. Its IUPAC name is but-3-enyl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | but-3-enyl thiophene-2-carboxylate |
| PubChem CID | 102577380 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | but-3-enyl thiophene-2-carboxylate |
| SMILES | C=CCCOC(=O)c1cccs1 |
| InChI | InChI=1S/C9H10O2S/c1-2-3-6-11-9(10)8-5-4-7-12-8/h2,4-5,7H,1,3,6H2 |
| InChIKey | NLGHJZLDNSYPFB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl thiophene-2-carboxylate?
The IUPAC name of but-3-enyl thiophene-2-carboxylate (CID 102577380) is but-3-enyl thiophene-2-carboxylate.
What is the SMILES notation for but-3-enyl thiophene-2-carboxylate?
The canonical SMILES for but-3-enyl thiophene-2-carboxylate is C=CCCOC(=O)c1cccs1.
What is the InChIKey of but-3-enyl thiophene-2-carboxylate?
The InChIKey is NLGHJZLDNSYPFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S/c1-2-3-6-11-9(10)8-5-4-7-12-8/h2,4-5,7H,1,3,6H2.
What are the key properties of but-3-enyl thiophene-2-carboxylate?
but-3-enyl thiophene-2-carboxylate has a molecular weight of 182.24 g/mol, XLogP of 2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl thiophene-2-carboxylate is sourced from PubChem (CID 102577380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).