C17H23NO8 — CID 102577457
ethyl 2-[(1R,2R,3S,4S,5S,6R)-2,4,5-trihydroxy-6-nitro-3-phenylmethoxycyclohexyl]acetate (PubChem CID 102577457) has the molecular formula C17H23NO8 and a molecular weight of 369.37 g/mol. Its IUPAC name is ethyl 2-[(1R,2R,3S,4S,5S,6R)-2,4,5-trihydroxy-6-nitro-3-phenylmethoxycyclohexyl]acetate.
| Compound Name | ethyl 2-[(1R,2R,3S,4S,5S,6R)-2,4,5-trihydroxy-6-nitro-3-phenylmethoxycyclohexyl]acetate |
|---|---|
| PubChem CID | 102577457 |
| Molecular Formula | C17H23NO8 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | ethyl 2-[(1R,2R,3S,4S,5S,6R)-2,4,5-trihydroxy-6-nitro-3-phenylmethoxycyclohexyl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@@H](O)[C@H](OCc2ccccc2)[C@@H](O)[C@@H](O)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C17H23NO8/c1-2-25-12(19)8-11-13(18(23)24)15(21)16(22)17(14(11)20)26-9-10-6-4-3-5-7-10/h3-7,11,13-17,20-22H,2,8-9H2,1H3/t11-,13-,14-,15+,16+,17+/m1/s1 |
| InChIKey | JYCRYWJNTQJCTR-FPNFNFKQSA-N |
| XLogP | -0.12 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|