C19H18N2O — CID 102577871
2-methyl-4,5-diphenyl-4-prop-2-enylpyrazol-3-one (PubChem CID 102577871) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-methyl-4,5-diphenyl-4-prop-2-enylpyrazol-3-one.
| Compound Name | 2-methyl-4,5-diphenyl-4-prop-2-enylpyrazol-3-one |
|---|---|
| PubChem CID | 102577871 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-methyl-4,5-diphenyl-4-prop-2-enylpyrazol-3-one |
| SMILES | C=CCC1(c2ccccc2)C(=O)N(C)N=C1c1ccccc1 |
| InChI | InChI=1S/C19H18N2O/c1-3-14-19(16-12-8-5-9-13-16)17(20-21(2)18(19)22)15-10-6-4-7-11-15/h3-13H,1,14H2,2H3 |
| InChIKey | ONWGTVAWZSKXFG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|