C14H21NO3 — CID 102578458
methyl 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 102578458) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is methyl 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | methyl 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 102578458 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | methyl 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=C/C=C(/OCC)C1=CCCC(C)N1C(=O)OC |
| InChI | InChI=1S/C14H21NO3/c1-5-8-13(18-6-2)12-10-7-9-11(3)15(12)14(16)17-4/h5,8,10-11H,1,6-7,9H2,2-4H3/b13-8+ |
| InChIKey | XWOMDXWKYVPATH-MDWZMJQESA-N |
| XLogP | 3.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|