About 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran
6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran (PubChem CID 102578465) has the molecular formula C12H18OS
and a molecular weight of 210.34 g/mol. Its IUPAC name is 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran.
Molecular Properties
| Compound Name | 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran |
| PubChem CID | 102578465 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran |
| SMILES | C=C/C=C(/OCC)C1=CCCC(C)S1 |
| InChI | InChI=1S/C12H18OS/c1-4-7-11(13-5-2)12-9-6-8-10(3)14-12/h4,7,9-10H,1,5-6,8H2,2-3H3/b11-7+ |
| InChIKey | QJDTYCHPPBDDNV-YRNVUSSQSA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran?
The IUPAC name of 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran (CID 102578465) is 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran.
What is the SMILES notation for 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran?
The canonical SMILES for 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran is C=C/C=C(/OCC)C1=CCCC(C)S1.
What is the InChIKey of 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran?
The InChIKey is QJDTYCHPPBDDNV-YRNVUSSQSA-N. The full InChI is InChI=1S/C12H18OS/c1-4-7-11(13-5-2)12-9-6-8-10(3)14-12/h4,7,9-10H,1,5-6,8H2,2-3H3/b11-7+.
What are the key properties of 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran?
6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran has a molecular weight of 210.34 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1E)-1-ethoxybuta-1,3-dienyl]-2-methyl-3,4-dihydro-2H-thiopyran is sourced from PubChem (CID 102578465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).