C13H24ClO4P — CID 102578556
5-chloro-2-diethoxyphosphorylnona-2,3-dien-1-ol (PubChem CID 102578556) has the molecular formula C13H24ClO4P and a molecular weight of 310.76 g/mol. Its IUPAC name is 5-chloro-2-diethoxyphosphorylnona-2,3-dien-1-ol.
| Compound Name | 5-chloro-2-diethoxyphosphorylnona-2,3-dien-1-ol |
|---|---|
| PubChem CID | 102578556 |
| Molecular Formula | C13H24ClO4P |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-chloro-2-diethoxyphosphorylnona-2,3-dien-1-ol |
| SMILES | CCCCC(Cl)C=C=C(CO)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H24ClO4P/c1-4-7-8-12(14)9-10-13(11-15)19(16,17-5-2)18-6-3/h9,12,15H,4-8,11H2,1-3H3 |
| InChIKey | QVWNHKGSAIWRAN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|