C18H23N4O5P3 — CID 102578777
15,15-diphenoxy-5,9,13-trioxa-1,7,14,16-tetraza-6λ5,8λ5,15λ5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene (PubChem CID 102578777) has the molecular formula C18H23N4O5P3 and a molecular weight of 468.33 g/mol. Its IUPAC name is 15,15-diphenoxy-5,9,13-trioxa-1,7,14,16-tetraza-6λ5,8λ5,15λ5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene.
| Compound Name | 15,15-diphenoxy-5,9,13-trioxa-1,7,14,16-tetraza-6λ5,8λ5,15λ5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene |
|---|---|
| PubChem CID | 102578777 |
| Molecular Formula | C18H23N4O5P3 |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 15,15-diphenoxy-5,9,13-trioxa-1,7,14,16-tetraza-6λ5,8λ5,15λ5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene |
| SMILES | c1ccc(OP2(Oc3ccccc3)=NP3(=NP4(=N2)OCCCO4)NCCCO3)cc1 |
| InChI | InChI=1S/C18H23N4O5P3/c1-3-9-17(10-4-1)26-30(27-18-11-5-2-6-12-18)21-28(19-13-7-14-23-28)20-29(22-30)24-15-8-16-25-29/h1-6,9-12,19H,7-8,13-16H2 |
| InChIKey | GMBISBXXKYVNRZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|