C10H4Cl4S2 — CID 102579007
2,4,5,7-tetrachloronaphthalene-1,8-dithiol (PubChem CID 102579007) has the molecular formula C10H4Cl4S2 and a molecular weight of 330.09 g/mol. Its IUPAC name is 2,4,5,7-tetrachloronaphthalene-1,8-dithiol.
| Compound Name | 2,4,5,7-tetrachloronaphthalene-1,8-dithiol |
|---|---|
| PubChem CID | 102579007 |
| Molecular Formula | C10H4Cl4S2 |
| Molecular Weight | 330.09 g/mol |
| Exact Mass | 327.85 |
| IUPAC Name | 2,4,5,7-tetrachloronaphthalene-1,8-dithiol |
| SMILES | Sc1c(Cl)cc(Cl)c2c(Cl)cc(Cl)c(S)c12 |
| InChI | InChI=1S/C10H4Cl4S2/c11-3-1-5(13)9(15)8-7(3)4(12)2-6(14)10(8)16/h1-2,15-16H |
| InChIKey | QCEQGTFLEMVUEZ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.09 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|