C22H20F2N2O5 — CID 102579246
methyl (2S)-2-[[(2R,3R)-4-(1,3-dioxoisoindol-2-yl)-2,3-difluorobutanoyl]amino]-3-phenylpropanoate (PubChem CID 102579246) has the molecular formula C22H20F2N2O5 and a molecular weight of 430.41 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R,3R)-4-(1,3-dioxoisoindol-2-yl)-2,3-difluorobutanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[(2R,3R)-4-(1,3-dioxoisoindol-2-yl)-2,3-difluorobutanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 102579246 |
| Molecular Formula | C22H20F2N2O5 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | methyl (2S)-2-[[(2R,3R)-4-(1,3-dioxoisoindol-2-yl)-2,3-difluorobutanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](F)[C@H](F)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H20F2N2O5/c1-31-22(30)17(11-13-7-3-2-4-8-13)25-19(27)18(24)16(23)12-26-20(28)14-9-5-6-10-15(14)21(26)29/h2-10,16-18H,11-12H2,1H3,(H,25,27)/t16-,17+,18+/m1/s1 |
| InChIKey | RTNCKWGYMBXPRA-SQNIBIBYSA-N |
| XLogP | 1.86 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|