C24H26INO3 — CID 102579333
2-[(2S,5R,7R,8R,10R)-2-(iodomethyl)-7,8-diphenyl-1,6,9-trioxaspiro[4.7]dodecan-10-yl]acetonitrile (PubChem CID 102579333) has the molecular formula C24H26INO3 and a molecular weight of 503.38 g/mol. Its IUPAC name is 2-[(2S,5R,7R,8R,10R)-2-(iodomethyl)-7,8-diphenyl-1,6,9-trioxaspiro[4.7]dodecan-10-yl]acetonitrile.
| Compound Name | 2-[(2S,5R,7R,8R,10R)-2-(iodomethyl)-7,8-diphenyl-1,6,9-trioxaspiro[4.7]dodecan-10-yl]acetonitrile |
|---|---|
| PubChem CID | 102579333 |
| Molecular Formula | C24H26INO3 |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 2-[(2S,5R,7R,8R,10R)-2-(iodomethyl)-7,8-diphenyl-1,6,9-trioxaspiro[4.7]dodecan-10-yl]acetonitrile |
| SMILES | N#CC[C@H]1CC[C@@]2(CC[C@@H](CI)O2)O[C@H](c2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C24H26INO3/c25-17-21-12-15-24(28-21)14-11-20(13-16-26)27-22(18-7-3-1-4-8-18)23(29-24)19-9-5-2-6-10-19/h1-10,20-23H,11-15,17H2/t20-,21+,22-,23-,24+/m1/s1 |
| InChIKey | SMWJLDMTZOOIJR-HUUMMWPTSA-N |
| XLogP | 5.89 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|