C18H26O3 — CID 102579492
(3'S,3'aR,7'aR)-1',2,2,3',3'a,5'-hexamethylspiro[1,3-dioxane-5,7'-3,7a-dihydroindene]-4'-one (PubChem CID 102579492) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (3'S,3'aR,7'aR)-1',2,2,3',3'a,5'-hexamethylspiro[1,3-dioxane-5,7'-3,7a-dihydroindene]-4'-one.
| Compound Name | (3'S,3'aR,7'aR)-1',2,2,3',3'a,5'-hexamethylspiro[1,3-dioxane-5,7'-3,7a-dihydroindene]-4'-one |
|---|---|
| PubChem CID | 102579492 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (3'S,3'aR,7'aR)-1',2,2,3',3'a,5'-hexamethylspiro[1,3-dioxane-5,7'-3,7a-dihydroindene]-4'-one |
| SMILES | CC1=CC2(COC(C)(C)OC2)[C@H]2C(C)=C[C@H](C)[C@@]2(C)C1=O |
| InChI | InChI=1S/C18H26O3/c1-11-7-13(3)17(6)14(11)18(8-12(2)15(17)19)9-20-16(4,5)21-10-18/h7-8,13-14H,9-10H2,1-6H3/t13-,14-,17+/m0/s1 |
| InChIKey | MXIPDQWXPLKINQ-GRDNDAEWSA-N |
| XLogP | 3.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|