C26H42O4Si — CID 102579496
(1R,4S,7S,9S,10R,11S,12R)-9-[(E)-but-2-en-2-yl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6,10,11-tetramethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one (PubChem CID 102579496) has the molecular formula C26H42O4Si and a molecular weight of 446.70 g/mol. Its IUPAC name is (1R,4S,7S,9S,10R,11S,12R)-9-[(E)-but-2-en-2-yl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6,10,11-tetramethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one.
| Compound Name | (1R,4S,7S,9S,10R,11S,12R)-9-[(E)-but-2-en-2-yl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6,10,11-tetramethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one |
|---|---|
| PubChem CID | 102579496 |
| Molecular Formula | C26H42O4Si |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | (1R,4S,7S,9S,10R,11S,12R)-9-[(E)-but-2-en-2-yl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6,10,11-tetramethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one |
| SMILES | C/C=C(\C)[C@@H]1O[C@H]2C(C)=C[C@@]3(CO[Si](C)(C)C(C)(C)C)CO[C@@]4(C)C(=O)[C@]1(C)[C@]2(C)[C@@H]34 |
| InChI | InChI=1S/C26H42O4Si/c1-12-16(2)18-24(8)21(27)25(9)20-23(24,7)19(30-18)17(3)13-26(20,14-28-25)15-29-31(10,11)22(4,5)6/h12-13,18-20H,14-15H2,1-11H3/b16-12+/t18-,19-,20+,23-,24+,25+,26-/m0/s1 |
| InChIKey | ISVTYZRRQGEYBF-NHFXKQPPSA-N |
| XLogP | 5.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|