About 1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol
1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol (PubChem CID 102579598) has the molecular formula C18H22O6
and a molecular weight of 334.37 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol.
Molecular Properties
| Compound Name | 1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol |
| PubChem CID | 102579598 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol |
| SMILES | COc1cc(OC)cc(C(O)C(CO)Oc2ccccc2OC)c1 |
| InChI | InChI=1S/C18H22O6/c1-21-13-8-12(9-14(10-13)22-2)18(20)17(11-19)24-16-7-5-4-6-15(16)23-3/h4-10,17-20H,11H2,1-3H3 |
| InChIKey | JOPPGUAIXZXCHH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol?
The IUPAC name of 1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol (CID 102579598) is 1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol.
What is the SMILES notation for 1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol?
The canonical SMILES for 1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol is COc1cc(OC)cc(C(O)C(CO)Oc2ccccc2OC)c1.
What is the InChIKey of 1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol?
The InChIKey is JOPPGUAIXZXCHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O6/c1-21-13-8-12(9-14(10-13)22-2)18(20)17(11-19)24-16-7-5-4-6-15(16)23-3/h4-10,17-20H,11H2,1-3H3.
What are the key properties of 1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol?
1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol has a molecular weight of 334.37 g/mol, XLogP of 2.19, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethoxyphenyl)-2-(2-methoxyphenoxy)propane-1,3-diol is sourced from PubChem (CID 102579598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).