C18H17NO — CID 102579765
4,4-diphenyl-2-prop-1-en-2-yl-5H-1,3-oxazole (PubChem CID 102579765) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is 4,4-diphenyl-2-prop-1-en-2-yl-5H-1,3-oxazole.
| Compound Name | 4,4-diphenyl-2-prop-1-en-2-yl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 102579765 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4,4-diphenyl-2-prop-1-en-2-yl-5H-1,3-oxazole |
| SMILES | C=C(C)C1=NC(c2ccccc2)(c2ccccc2)CO1 |
| InChI | InChI=1S/C18H17NO/c1-14(2)17-19-18(13-20-17,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,1,13H2,2H3 |
| InChIKey | XKZXRCJMRTVSJC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |