C16H8N2S3 — CID 102580102
5,12,17-trithia-3,21-diazahexacyclo[13.6.0.02,9.04,8.010,14.016,20]henicosa-1(15),2(9),4(8),6,10,13,16(20),18-octaene (PubChem CID 102580102) has the molecular formula C16H8N2S3 and a molecular weight of 324.45 g/mol. Its IUPAC name is 5,12,17-trithia-3,21-diazahexacyclo[13.6.0.02,9.04,8.010,14.016,20]henicosa-1(15),2(9),4(8),6,10,13,16(20),18-octaene.
| Compound Name | 5,12,17-trithia-3,21-diazahexacyclo[13.6.0.02,9.04,8.010,14.016,20]henicosa-1(15),2(9),4(8),6,10,13,16(20),18-octaene |
|---|---|
| PubChem CID | 102580102 |
| Molecular Formula | C16H8N2S3 |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 5,12,17-trithia-3,21-diazahexacyclo[13.6.0.02,9.04,8.010,14.016,20]henicosa-1(15),2(9),4(8),6,10,13,16(20),18-octaene |
| SMILES | c1cc2c([nH]c3c4[nH]c5ccsc5c4c4cscc4c23)s1 |
| InChI | InChI=1S/C16H8N2S3/c1-3-21-16-7(1)11-8-5-19-6-9(8)12-14(13(11)18-16)17-10-2-4-20-15(10)12/h1-6,17-18H |
| InChIKey | OLFBOSNUVLJTDX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |