C18H54O11Si10 — CID 102580500
(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)oxy-[(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)oxy-dimethylsilyl]oxy-dimethylsilane (PubChem CID 102580500) has the molecular formula C18H54O11Si10 and a molecular weight of 727.48 g/mol. Its IUPAC name is (2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)oxy-[(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)oxy-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | (2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)oxy-[(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)oxy-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102580500 |
| Molecular Formula | C18H54O11Si10 |
| Molecular Weight | 727.48 g/mol |
| Exact Mass | 726.14 |
| IUPAC Name | (2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)oxy-[(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)oxy-dimethylsilyl]oxy-dimethylsilane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(O[Si](C)(C)O[Si](C)(C)O[Si]2(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O2)O[Si](C)(C)O1 |
| InChI | InChI=1S/C18H54O11Si10/c1-30(2)19-32(5,6)24-38(17,25-33(7,8)20-30)28-36(13,14)23-37(15,16)29-39(18)26-34(9,10)21-31(3,4)22-35(11,12)27-39/h1-18H3 |
| InChIKey | YGYPCSOMDUSPIG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|