C22H32O6 — CID 102580803
methyl (1S,4aS,5R,8aS)-5-[(3S)-5-methoxy-3-methyl-2,5-dioxopentyl]-1,4a,6-trimethyl-8-oxo-3,4,5,8a-tetrahydro-2H-naphthalene-1-carboxylate (PubChem CID 102580803) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is methyl (1S,4aS,5R,8aS)-5-[(3S)-5-methoxy-3-methyl-2,5-dioxopentyl]-1,4a,6-trimethyl-8-oxo-3,4,5,8a-tetrahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aS,5R,8aS)-5-[(3S)-5-methoxy-3-methyl-2,5-dioxopentyl]-1,4a,6-trimethyl-8-oxo-3,4,5,8a-tetrahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 102580803 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | methyl (1S,4aS,5R,8aS)-5-[(3S)-5-methoxy-3-methyl-2,5-dioxopentyl]-1,4a,6-trimethyl-8-oxo-3,4,5,8a-tetrahydro-2H-naphthalene-1-carboxylate |
| SMILES | COC(=O)C[C@H](C)C(=O)C[C@@H]1C(C)=CC(=O)[C@H]2[C@@]1(C)CCC[C@]2(C)C(=O)OC |
| InChI | InChI=1S/C22H32O6/c1-13-10-17(24)19-21(3,8-7-9-22(19,4)20(26)28-6)15(13)12-16(23)14(2)11-18(25)27-5/h10,14-15,19H,7-9,11-12H2,1-6H3/t14-,15+,19-,21-,22-/m0/s1 |
| InChIKey | ZMRJLIHLGUOEPR-FSASGHHFSA-N |
| XLogP | 3.28 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |