C22H19N3O — CID 102581194
1-(4-methoxyphenyl)-N,3-diphenylpyrazol-5-amine (PubChem CID 102581194) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N,3-diphenylpyrazol-5-amine.
| Compound Name | 1-(4-methoxyphenyl)-N,3-diphenylpyrazol-5-amine |
|---|---|
| PubChem CID | 102581194 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-N,3-diphenylpyrazol-5-amine |
| SMILES | COc1ccc(-n2nc(-c3ccccc3)cc2Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N3O/c1-26-20-14-12-19(13-15-20)25-22(23-18-10-6-3-7-11-18)16-21(24-25)17-8-4-2-5-9-17/h2-16,23H,1H3 |
| InChIKey | IMKPDOZNADXYME-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |