C11H11Cl3O8 — CID 102581280
[(3'aS,6S,6'R,6'aR)-3-hydroxy-2'-(trichloromethyl)spiro[3H-1,2-dioxine-6,5'-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-6'-yl] acetate (PubChem CID 102581280) has the molecular formula C11H11Cl3O8 and a molecular weight of 377.56 g/mol. Its IUPAC name is [(3'aS,6S,6'R,6'aR)-3-hydroxy-2'-(trichloromethyl)spiro[3H-1,2-dioxine-6,5'-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-6'-yl] acetate.
| Compound Name | [(3'aS,6S,6'R,6'aR)-3-hydroxy-2'-(trichloromethyl)spiro[3H-1,2-dioxine-6,5'-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-6'-yl] acetate |
|---|---|
| PubChem CID | 102581280 |
| Molecular Formula | C11H11Cl3O8 |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | [(3'aS,6S,6'R,6'aR)-3-hydroxy-2'-(trichloromethyl)spiro[3H-1,2-dioxine-6,5'-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-6'-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2OC(C(Cl)(Cl)Cl)O[C@H]2O[C@]12C=CC(O)OO2 |
| InChI | InChI=1S/C11H11Cl3O8/c1-4(15)17-7-6-8(19-9(18-6)11(12,13)14)20-10(7)3-2-5(16)21-22-10/h2-3,5-9,16H,1H3/t5?,6-,7-,8+,9?,10+/m1/s1 |
| InChIKey | URXIPQZLFXFVCF-ZTWQWAOLSA-N |
| XLogP | 0.92 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|