C10H11Cl3O7 — CID 102581281
(3'aS,6S,6'R,6'aR)-6'-methoxy-2'-(trichloromethyl)spiro[3H-1,2-dioxine-6,5'-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-3-ol (PubChem CID 102581281) has the molecular formula C10H11Cl3O7 and a molecular weight of 349.55 g/mol. Its IUPAC name is (3'aS,6S,6'R,6'aR)-6'-methoxy-2'-(trichloromethyl)spiro[3H-1,2-dioxine-6,5'-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-3-ol.
| Compound Name | (3'aS,6S,6'R,6'aR)-6'-methoxy-2'-(trichloromethyl)spiro[3H-1,2-dioxine-6,5'-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-3-ol |
|---|---|
| PubChem CID | 102581281 |
| Molecular Formula | C10H11Cl3O7 |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | (3'aS,6S,6'R,6'aR)-6'-methoxy-2'-(trichloromethyl)spiro[3H-1,2-dioxine-6,5'-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-3-ol |
| SMILES | CO[C@@H]1[C@H]2OC(C(Cl)(Cl)Cl)O[C@H]2O[C@]12C=CC(O)OO2 |
| InChI | InChI=1S/C10H11Cl3O7/c1-15-6-5-7(17-8(16-5)10(11,12)13)18-9(6)3-2-4(14)19-20-9/h2-8,14H,1H3/t4?,5-,6-,7+,8?,9+/m1/s1 |
| InChIKey | DOVOZKDVKQFHAZ-SUPXLQRUSA-N |
| XLogP | 1.00 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|