C12H15Cl3O6 — CID 102581283
(5S)-5',6-dimethoxy-5'-methyl-2-(trichloromethyl)spiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,2'-furan] (PubChem CID 102581283) has the molecular formula C12H15Cl3O6 and a molecular weight of 361.61 g/mol. Its IUPAC name is (5S)-5',6-dimethoxy-5'-methyl-2-(trichloromethyl)spiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,2'-furan].
| Compound Name | (5S)-5',6-dimethoxy-5'-methyl-2-(trichloromethyl)spiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,2'-furan] |
|---|---|
| PubChem CID | 102581283 |
| Molecular Formula | C12H15Cl3O6 |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | (5S)-5',6-dimethoxy-5'-methyl-2-(trichloromethyl)spiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,2'-furan] |
| SMILES | COC1C2OC(C(Cl)(Cl)Cl)OC2O[C@]12C=CC(C)(OC)O2 |
| InChI | InChI=1S/C12H15Cl3O6/c1-10(17-3)4-5-11(21-10)7(16-2)6-8(20-11)19-9(18-6)12(13,14)15/h4-9H,1-3H3/t6?,7?,8?,9?,10?,11-/m0/s1 |
| InChIKey | GBVNJZOZQAVZKH-QTDCSAEMSA-N |
| XLogP | 2.11 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|