C13H15Cl3O7 — CID 102581284
[(5S)-5'-methoxy-5'-methyl-2-(trichloromethyl)spiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,2'-furan]-6-yl] acetate (PubChem CID 102581284) has the molecular formula C13H15Cl3O7 and a molecular weight of 389.62 g/mol. Its IUPAC name is [(5S)-5'-methoxy-5'-methyl-2-(trichloromethyl)spiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,2'-furan]-6-yl] acetate.
| Compound Name | [(5S)-5'-methoxy-5'-methyl-2-(trichloromethyl)spiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,2'-furan]-6-yl] acetate |
|---|---|
| PubChem CID | 102581284 |
| Molecular Formula | C13H15Cl3O7 |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | [(5S)-5'-methoxy-5'-methyl-2-(trichloromethyl)spiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,2'-furan]-6-yl] acetate |
| SMILES | COC1(C)C=C[C@]2(OC3OC(C(Cl)(Cl)Cl)OC3C2OC(C)=O)O1 |
| InChI | InChI=1S/C13H15Cl3O7/c1-6(17)19-8-7-9(21-10(20-7)13(14,15)16)22-12(8)5-4-11(2,18-3)23-12/h4-5,7-10H,1-3H3/t7?,8?,9?,10?,11?,12-/m0/s1 |
| InChIKey | ZTJXHPOWJDYAFI-ZVSPKCCMSA-N |
| XLogP | 2.03 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|