C32H40N4O8 — CID 102581444
3-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]-1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclobutane-1-carboxylic acid (PubChem CID 102581444) has the molecular formula C32H40N4O8 and a molecular weight of 608.69 g/mol. Its IUPAC name is 3-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]-1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclobutane-1-carboxylic acid.
| Compound Name | 3-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]-1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 102581444 |
| Molecular Formula | C32H40N4O8 |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | 3-[[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]methyl]-1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclobutane-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NC(=NCC1CC(NC(=O)OCC2c3ccccc3-c3ccccc32)(C(=O)O)C1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H40N4O8/c1-30(2,3)43-27(39)34-26(35-28(40)44-31(4,5)6)33-17-19-15-32(16-19,25(37)38)36-29(41)42-18-24-22-13-9-7-11-20(22)21-12-8-10-14-23(21)24/h7-14,19,24H,15-18H2,1-6H3,(H,36,41)(H,37,38)(H2,33,34,35,39,40) |
| InChIKey | AVMYFOHOWKZBHV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 164.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|