About 2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde
2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde (PubChem CID 102581625) has the molecular formula C24H22O2
and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde.
Molecular Properties
| Compound Name | 2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde |
| PubChem CID | 102581625 |
| Molecular Formula | C24H22O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde |
| SMILES | Cc1cc(C)c2cc(C=O)c3cc(C(C)(C)C)cc4c(C=O)cc1c2c43 |
| InChI | InChI=1S/C24H22O2/c1-13-6-14(2)19-8-16(12-26)21-10-17(24(3,4)5)9-20-15(11-25)7-18(13)22(19)23(20)21/h6-12H,1-5H3 |
| InChIKey | RYIHIVBHNQHSPU-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde?
The IUPAC name of 2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde (CID 102581625) is 2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde.
What is the SMILES notation for 2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde?
The canonical SMILES for 2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde is Cc1cc(C)c2cc(C=O)c3cc(C(C)(C)C)cc4c(C=O)cc1c2c43.
What is the InChIKey of 2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde?
The InChIKey is RYIHIVBHNQHSPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O2/c1-13-6-14(2)19-8-16(12-26)21-10-17(24(3,4)5)9-20-15(11-25)7-18(13)22(19)23(20)21/h6-12H,1-5H3.
What are the key properties of 2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde?
2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde has a molecular weight of 342.44 g/mol, XLogP of 6.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6,8-dimethylpyrene-4,10-dicarbaldehyde is sourced from PubChem (CID 102581625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).