About ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate
ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate (PubChem CID 102581687) has the molecular formula C15H17NO2
and a molecular weight of 243.31 g/mol. Its IUPAC name is ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate |
| PubChem CID | 102581687 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate |
| SMILES | CCOC(=O)c1c2n(c3cc(C)ccc13)CCC2 |
| InChI | InChI=1S/C15H17NO2/c1-3-18-15(17)14-11-7-6-10(2)9-13(11)16-8-4-5-12(14)16/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | GLUFKZPAZRJQJI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate?
The IUPAC name of ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate (CID 102581687) is ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate.
What is the SMILES notation for ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate?
The canonical SMILES for ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate is CCOC(=O)c1c2n(c3cc(C)ccc13)CCC2.
What is the InChIKey of ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate?
The InChIKey is GLUFKZPAZRJQJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2/c1-3-18-15(17)14-11-7-6-10(2)9-13(11)16-8-4-5-12(14)16/h6-7,9H,3-5,8H2,1-2H3.
What are the key properties of ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate?
ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate has a molecular weight of 243.31 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate is sourced from PubChem (CID 102581687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).