C14H7Br7 — CID 102581798
(1S,2R,3S,4R)-1,2,3,4,6,9,10-heptabromo-1,2,3,4-tetrahydroanthracene (PubChem CID 102581798) has the molecular formula C14H7Br7 and a molecular weight of 734.54 g/mol. Its IUPAC name is (1S,2R,3S,4R)-1,2,3,4,6,9,10-heptabromo-1,2,3,4-tetrahydroanthracene.
| Compound Name | (1S,2R,3S,4R)-1,2,3,4,6,9,10-heptabromo-1,2,3,4-tetrahydroanthracene |
|---|---|
| PubChem CID | 102581798 |
| Molecular Formula | C14H7Br7 |
| Molecular Weight | 734.54 g/mol |
| Exact Mass | 727.48 |
| IUPAC Name | (1S,2R,3S,4R)-1,2,3,4,6,9,10-heptabromo-1,2,3,4-tetrahydroanthracene |
| SMILES | Brc1ccc2c(Br)c3c(c(Br)c2c1)[C@@H](Br)[C@H](Br)[C@H](Br)[C@H]3Br |
| InChI | InChI=1S/C14H7Br7/c15-4-1-2-5-6(3-4)10(17)8-7(9(5)16)11(18)13(20)14(21)12(8)19/h1-3,11-14H/t11-,12+,13+,14-/m0/s1 |
| InChIKey | GKRKIIQITIPCHE-DGAVXFQQSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.54 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|