C31H50N2O6S2 — CID 10258180
3-[N-butyl-4-[[4-[butyl(3-sulfopropyl)amino]-2,6-dimethylphenyl]methyl]-3,5-dimethylanilino]propane-1-sulfonic acid (PubChem CID 10258180) has the molecular formula C31H50N2O6S2 and a molecular weight of 610.88 g/mol. Its IUPAC name is 3-[N-butyl-4-[[4-[butyl(3-sulfopropyl)amino]-2,6-dimethylphenyl]methyl]-3,5-dimethylanilino]propane-1-sulfonic acid.
| Compound Name | 3-[N-butyl-4-[[4-[butyl(3-sulfopropyl)amino]-2,6-dimethylphenyl]methyl]-3,5-dimethylanilino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 10258180 |
| Molecular Formula | C31H50N2O6S2 |
| Molecular Weight | 610.88 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | 3-[N-butyl-4-[[4-[butyl(3-sulfopropyl)amino]-2,6-dimethylphenyl]methyl]-3,5-dimethylanilino]propane-1-sulfonic acid |
| SMILES | CCCCN(CCCS(=O)(=O)O)c1cc(C)c(Cc2c(C)cc(N(CCCC)CCCS(=O)(=O)O)cc2C)c(C)c1 |
| InChI | InChI=1S/C31H50N2O6S2/c1-7-9-13-32(15-11-17-40(34,35)36)28-19-24(3)30(25(4)20-28)23-31-26(5)21-29(22-27(31)6)33(14-10-8-2)16-12-18-41(37,38)39/h19-22H,7-18,23H2,1-6H3,(H,34,35,36)(H,37,38,39) |
| InChIKey | WFESQFQHOMXUQQ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.88 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|