C38H50N3O5+ — CID 102582487
ethyl 5-[20-(5-ethoxy-5-oxopentyl)-7,7,9,17,19,19-hexamethyl-2-oxa-6,13-diaza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3(12),4,8,10,13,15,17,20-nonaen-6-yl]pentanoate (PubChem CID 102582487) has the molecular formula C38H50N3O5+ and a molecular weight of 628.83 g/mol. Its IUPAC name is ethyl 5-[20-(5-ethoxy-5-oxopentyl)-7,7,9,17,19,19-hexamethyl-2-oxa-6,13-diaza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3(12),4,8,10,13,15,17,20-nonaen-6-yl]pentanoate.
| Compound Name | ethyl 5-[20-(5-ethoxy-5-oxopentyl)-7,7,9,17,19,19-hexamethyl-2-oxa-6,13-diaza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3(12),4,8,10,13,15,17,20-nonaen-6-yl]pentanoate |
|---|---|
| PubChem CID | 102582487 |
| Molecular Formula | C38H50N3O5+ |
| Molecular Weight | 628.83 g/mol |
| Exact Mass | 628.37 |
| IUPAC Name | ethyl 5-[20-(5-ethoxy-5-oxopentyl)-7,7,9,17,19,19-hexamethyl-2-oxa-6,13-diaza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3(12),4,8,10,13,15,17,20-nonaen-6-yl]pentanoate |
| SMILES | CCOC(=O)CCCCN1c2cc3c(cc2C(C)=CC1(C)C)N=c1cc2c(cc1O3)=[N+](CCCCC(=O)OCC)C(C)(C)C=C2C |
| InChI | InChI=1S/C38H50N3O5/c1-9-44-35(42)15-11-13-17-40-31-21-33-29(19-27(31)25(3)23-37(40,5)6)39-30-20-28-26(4)24-38(7,8)41(32(28)22-34(30)46-33)18-14-12-16-36(43)45-10-2/h19-24H,9-18H2,1-8H3/q+1 |
| InChIKey | OOIVKLOYHKEMMU-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 80.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.83 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|