C30H38N3O3+ — CID 102582488
ethyl 5-(20-ethyl-7,7,9-trimethyl-2-oxa-6,13-diaza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3(12),4,8,10,13,15,20-octaen-6-yl)pentanoate (PubChem CID 102582488) has the molecular formula C30H38N3O3+ and a molecular weight of 488.65 g/mol. Its IUPAC name is ethyl 5-(20-ethyl-7,7,9-trimethyl-2-oxa-6,13-diaza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3(12),4,8,10,13,15,20-octaen-6-yl)pentanoate.
| Compound Name | ethyl 5-(20-ethyl-7,7,9-trimethyl-2-oxa-6,13-diaza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3(12),4,8,10,13,15,20-octaen-6-yl)pentanoate |
|---|---|
| PubChem CID | 102582488 |
| Molecular Formula | C30H38N3O3+ |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | ethyl 5-(20-ethyl-7,7,9-trimethyl-2-oxa-6,13-diaza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3(12),4,8,10,13,15,20-octaen-6-yl)pentanoate |
| SMILES | CCOC(=O)CCCCN1c2cc3c(cc2C(C)=CC1(C)C)N=c1cc2c(cc1O3)=[N+](CC)CCC2 |
| InChI | InChI=1S/C30H38N3O3/c1-6-32-13-10-11-21-15-23-27(17-25(21)32)36-28-18-26-22(16-24(28)31-23)20(3)19-30(4,5)33(26)14-9-8-12-29(34)35-7-2/h15-19H,6-14H2,1-5H3/q+1 |
| InChIKey | FGUUHMDAVPAJNI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 54.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|