About 1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene
1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene (PubChem CID 102582957) has the molecular formula C22H18FNO6S2
and a molecular weight of 475.52 g/mol. Its IUPAC name is 1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene.
Molecular Properties
| Compound Name | 1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene |
| PubChem CID | 102582957 |
| Molecular Formula | C22H18FNO6S2 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene |
| SMILES | O=[N+]([O-])/C(=C\c1ccc(F)cc1)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18FNO6S2/c23-18-13-11-17(12-14-18)15-19(24(25)26)16-22(31(27,28)20-7-3-1-4-8-20)32(29,30)21-9-5-2-6-10-21/h1-15,22H,16H2/b19-15- |
| InChIKey | CGJRIFHGHPEMRM-CYVLTUHYSA-N |
| XLogP | 4.11 |
| TPSA | 111.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene?
The IUPAC name of 1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene (CID 102582957) is 1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene.
What is the SMILES notation for 1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene?
The canonical SMILES for 1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene is O=[N+]([O-])/C(=C\c1ccc(F)cc1)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of 1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene?
The InChIKey is CGJRIFHGHPEMRM-CYVLTUHYSA-N. The full InChI is InChI=1S/C22H18FNO6S2/c23-18-13-11-17(12-14-18)15-19(24(25)26)16-22(31(27,28)20-7-3-1-4-8-20)32(29,30)21-9-5-2-6-10-21/h1-15,22H,16H2/b19-15-.
What are the key properties of 1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene?
1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene has a molecular weight of 475.52 g/mol, XLogP of 4.11, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]-4-fluorobenzene is sourced from PubChem (CID 102582957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).