C26H38N4O2Si2 — CID 102583288
trimethyl-[2-[[3-[1-(2-trimethylsilylethoxymethyl)indazol-3-yl]indazol-1-yl]methoxy]ethyl]silane (PubChem CID 102583288) has the molecular formula C26H38N4O2Si2 and a molecular weight of 494.79 g/mol. Its IUPAC name is trimethyl-[2-[[3-[1-(2-trimethylsilylethoxymethyl)indazol-3-yl]indazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[3-[1-(2-trimethylsilylethoxymethyl)indazol-3-yl]indazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 102583288 |
| Molecular Formula | C26H38N4O2Si2 |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | trimethyl-[2-[[3-[1-(2-trimethylsilylethoxymethyl)indazol-3-yl]indazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2nn(COCC[Si](C)(C)C)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C26H38N4O2Si2/c1-33(2,3)17-15-31-19-29-23-13-9-7-11-21(23)25(27-29)26-22-12-8-10-14-24(22)30(28-26)20-32-16-18-34(4,5)6/h7-14H,15-20H2,1-6H3 |
| InChIKey | IKKUYJGFVRAZMI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|