C24H24N4O5 — CID 102583431
(3aR,5R,6S,6aR)-5-[[4-(4-methoxyphenyl)triazolo[4,5-c]quinolin-1-yl]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 102583431) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-[[4-(4-methoxyphenyl)triazolo[4,5-c]quinolin-1-yl]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5R,6S,6aR)-5-[[4-(4-methoxyphenyl)triazolo[4,5-c]quinolin-1-yl]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 102583431 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-[[4-(4-methoxyphenyl)triazolo[4,5-c]quinolin-1-yl]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | COc1ccc(-c2nc3ccccc3c3c2nnn3C[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2O)cc1 |
| InChI | InChI=1S/C24H24N4O5/c1-24(2)32-22-21(29)17(31-23(22)33-24)12-28-20-15-6-4-5-7-16(15)25-18(19(20)26-27-28)13-8-10-14(30-3)11-9-13/h4-11,17,21-23,29H,12H2,1-3H3/t17-,21+,22-,23-/m1/s1 |
| InChIKey | GTDQJLCKKRNSMK-FJTGNWTPSA-N |
| XLogP | 2.89 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |