About 3-methoxypenta-1,2-dien-4-yne
3-methoxypenta-1,2-dien-4-yne (PubChem CID 102584050) has the molecular formula C6H6O
and a molecular weight of 94.11 g/mol. Its IUPAC name is 3-methoxypenta-1,2-dien-4-yne.
Molecular Properties
| Compound Name | 3-methoxypenta-1,2-dien-4-yne |
| PubChem CID | 102584050 |
| Molecular Formula | C6H6O |
| Molecular Weight | 94.11 g/mol |
| Exact Mass | 94.04 |
| IUPAC Name | 3-methoxypenta-1,2-dien-4-yne |
| SMILES | C#CC(=C=C)OC |
| InChI | InChI=1S/C6H6O/c1-4-6(5-2)7-3/h1H,2H2,3H3 |
| InChIKey | DDMCVMADRDJKKL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.11 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxypenta-1,2-dien-4-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxypenta-1,2-dien-4-yne?
The IUPAC name of 3-methoxypenta-1,2-dien-4-yne (CID 102584050) is 3-methoxypenta-1,2-dien-4-yne.
What is the SMILES notation for 3-methoxypenta-1,2-dien-4-yne?
The canonical SMILES for 3-methoxypenta-1,2-dien-4-yne is C#CC(=C=C)OC.
What is the InChIKey of 3-methoxypenta-1,2-dien-4-yne?
The InChIKey is DDMCVMADRDJKKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O/c1-4-6(5-2)7-3/h1H,2H2,3H3.
What are the key properties of 3-methoxypenta-1,2-dien-4-yne?
3-methoxypenta-1,2-dien-4-yne has a molecular weight of 94.11 g/mol, XLogP of 0.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypenta-1,2-dien-4-yne is sourced from PubChem (CID 102584050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).