C42H84N10O4 — CID 102585613
N-[(2S)-1-[10-[[(2S)-2-(decanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]decylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]decanamide (PubChem CID 102585613) has the molecular formula C42H84N10O4 and a molecular weight of 793.20 g/mol. Its IUPAC name is N-[(2S)-1-[10-[[(2S)-2-(decanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]decylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]decanamide.
| Compound Name | N-[(2S)-1-[10-[[(2S)-2-(decanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]decylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]decanamide |
|---|---|
| PubChem CID | 102585613 |
| Molecular Formula | C42H84N10O4 |
| Molecular Weight | 793.20 g/mol |
| Exact Mass | 792.67 |
| IUPAC Name | N-[(2S)-1-[10-[[(2S)-2-(decanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]decylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)N[C@@H](CCCN=C(N)N)C(=O)NCCCCCCCCCCNC(=O)[C@H](CCCN=C(N)N)NC(=O)CCCCCCCCC |
| InChI | InChI=1S/C42H84N10O4/c1-3-5-7-9-13-17-21-29-37(53)51-35(27-25-33-49-41(43)44)39(55)47-31-23-19-15-11-12-16-20-24-32-48-40(56)36(28-26-34-50-42(45)46)52-38(54)30-22-18-14-10-8-6-4-2/h35-36H,3-34H2,1-2H3,(H,47,55)(H,48,56)(H,51,53)(H,52,54)(H4,43,44,49)(H4,45,46,50)/t35-,36-/m0/s1 |
| InChIKey | CRVYZFABYLGLAH-ZPGRZCPFSA-N |
| XLogP | 5.70 |
| TPSA | 245.20 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.20 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|