C16H17NS2 — CID 102586072
2-(dimethylamino)-2-(4-phenylphenyl)ethanedithioic acid (PubChem CID 102586072) has the molecular formula C16H17NS2 and a molecular weight of 287.45 g/mol. Its IUPAC name is 2-(dimethylamino)-2-(4-phenylphenyl)ethanedithioic acid.
| Compound Name | 2-(dimethylamino)-2-(4-phenylphenyl)ethanedithioic acid |
|---|---|
| PubChem CID | 102586072 |
| Molecular Formula | C16H17NS2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-(dimethylamino)-2-(4-phenylphenyl)ethanedithioic acid |
| SMILES | CN(C)C(C(=S)S)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H17NS2/c1-17(2)15(16(18)19)14-10-8-13(9-11-14)12-6-4-3-5-7-12/h3-11,15H,1-2H3,(H,18,19) |
| InChIKey | YHSFCAFWOFSZJF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|