About (2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine
(2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine (PubChem CID 102586159) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is (2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine.
Molecular Properties
| Compound Name | (2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine |
| PubChem CID | 102586159 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | (2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine |
| SMILES | CO[C@@]1(C)OCC[C@@]1(C)NC1CCCCC1 |
| InChI | InChI=1S/C13H25NO2/c1-12(9-10-16-13(12,2)15-3)14-11-7-5-4-6-8-11/h11,14H,4-10H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | SZQPSRSZRZPPND-OLZOCXBDSA-N |
| XLogP | 2.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine?
The IUPAC name of (2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine (CID 102586159) is (2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine.
What is the SMILES notation for (2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine?
The canonical SMILES for (2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine is CO[C@@]1(C)OCC[C@@]1(C)NC1CCCCC1.
What is the InChIKey of (2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine?
The InChIKey is SZQPSRSZRZPPND-OLZOCXBDSA-N. The full InChI is InChI=1S/C13H25NO2/c1-12(9-10-16-13(12,2)15-3)14-11-7-5-4-6-8-11/h11,14H,4-10H2,1-3H3/t12-,13+/m1/s1.
What are the key properties of (2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine?
(2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine has a molecular weight of 227.35 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-N-cyclohexyl-2-methoxy-2,3-dimethyloxolan-3-amine is sourced from PubChem (CID 102586159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).