C10H10O7 — CID 102586601
[(1R,2S,6R,7R,8S)-4,10-dioxo-3,5,9-trioxatricyclo[5.3.0.02,6]decan-8-yl]methyl acetate (PubChem CID 102586601) has the molecular formula C10H10O7 and a molecular weight of 242.18 g/mol. Its IUPAC name is [(1R,2S,6R,7R,8S)-4,10-dioxo-3,5,9-trioxatricyclo[5.3.0.02,6]decan-8-yl]methyl acetate.
| Compound Name | [(1R,2S,6R,7R,8S)-4,10-dioxo-3,5,9-trioxatricyclo[5.3.0.02,6]decan-8-yl]methyl acetate |
|---|---|
| PubChem CID | 102586601 |
| Molecular Formula | C10H10O7 |
| Molecular Weight | 242.18 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | [(1R,2S,6R,7R,8S)-4,10-dioxo-3,5,9-trioxatricyclo[5.3.0.02,6]decan-8-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(=O)[C@H]2[C@@H]3OC(=O)O[C@@H]3[C@H]21 |
| InChI | InChI=1S/C10H10O7/c1-3(11)14-2-4-5-6(9(12)15-4)8-7(5)16-10(13)17-8/h4-8H,2H2,1H3/t4-,5+,6-,7-,8+/m1/s1 |
| InChIKey | IPXYMLOOEQHWJI-UOLFYFMNSA-N |
| XLogP | -0.38 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.18 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|