C16H35B2NO4Si — CID 102587208
4,4,5,5-tetramethyl-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(trimethylsilylmethyl)-1,3,2-dioxaborolan-2-amine (PubChem CID 102587208) has the molecular formula C16H35B2NO4Si and a molecular weight of 355.17 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(trimethylsilylmethyl)-1,3,2-dioxaborolan-2-amine.
| Compound Name | 4,4,5,5-tetramethyl-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(trimethylsilylmethyl)-1,3,2-dioxaborolan-2-amine |
|---|---|
| PubChem CID | 102587208 |
| Molecular Formula | C16H35B2NO4Si |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 4,4,5,5-tetramethyl-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(trimethylsilylmethyl)-1,3,2-dioxaborolan-2-amine |
| SMILES | CC1(C)OB(N(C[Si](C)(C)C)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C16H35B2NO4Si/c1-13(2)14(3,4)21-17(20-13)19(12-24(9,10)11)18-22-15(5,6)16(7,8)23-18/h12H2,1-11H3 |
| InChIKey | KLRAWRBVOWATTJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|